2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide

C9H10BrNO2 — CID 50987362

IUPAC2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide
SMILESBr.O=C(O)c1ccc2c(c1)CNC2
InChIInChI=1S/C9H9NO2.BrH/c11-9(12)6-1-2-7-4-10-5-8(7)3-6;/h1-3,10H,4-5H2,(H,11,12);1H
InChIKeyFRVDLQQVRKUAEU-UHFFFAOYSA-N
MW244.09 g/mol
LogP1.57
Rot. Bonds1

About 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide

2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide (PubChem CID 50987362) has the molecular formula C9H10BrNO2 and a molecular weight of 244.09 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide.

Molecular Properties

Compound Name2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide
PubChem CID50987362
Molecular FormulaC9H10BrNO2
Molecular Weight244.09 g/mol
Exact Mass242.99
IUPAC Name2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide
SMILESBr.O=C(O)c1ccc2c(c1)CNC2
InChIInChI=1S/C9H9NO2.BrH/c11-9(12)6-1-2-7-4-10-5-8(7)3-6;/h1-3,10H,4-5H2,(H,11,12);1H
InChIKeyFRVDLQQVRKUAEU-UHFFFAOYSA-N
XLogP1.57
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.09
LogP ≤ 51.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide?
The IUPAC name of 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide (CID 50987362) is 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide.
What is the SMILES notation for 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide?
The canonical SMILES for 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide is Br.O=C(O)c1ccc2c(c1)CNC2.
What is the InChIKey of 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide?
The InChIKey is FRVDLQQVRKUAEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2.BrH/c11-9(12)6-1-2-7-4-10-5-8(7)3-6;/h1-3,10H,4-5H2,(H,11,12);1H.
What are the key properties of 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide?
2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide has a molecular weight of 244.09 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide is sourced from PubChem (CID 50987362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).