About 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide
2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide (PubChem CID 50987362) has the molecular formula C9H10BrNO2
and a molecular weight of 244.09 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide |
| PubChem CID | 50987362 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide |
| SMILES | Br.O=C(O)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C9H9NO2.BrH/c11-9(12)6-1-2-7-4-10-5-8(7)3-6;/h1-3,10H,4-5H2,(H,11,12);1H |
| InChIKey | FRVDLQQVRKUAEU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide?
The IUPAC name of 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide (CID 50987362) is 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide.
What is the SMILES notation for 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide?
The canonical SMILES for 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide is Br.O=C(O)c1ccc2c(c1)CNC2.
What is the InChIKey of 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide?
The InChIKey is FRVDLQQVRKUAEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2.BrH/c11-9(12)6-1-2-7-4-10-5-8(7)3-6;/h1-3,10H,4-5H2,(H,11,12);1H.
What are the key properties of 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide?
2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide has a molecular weight of 244.09 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-isoindole-5-carboxylic acid;hydrobromide is sourced from PubChem (CID 50987362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).