C6H12N4 — CID 50987516
3-(1,2,4-triazol-1-yl)butan-2-amine (PubChem CID 50987516) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 3-(1,2,4-triazol-1-yl)butan-2-amine.
| Compound Name | 3-(1,2,4-triazol-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 50987516 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 3-(1,2,4-triazol-1-yl)butan-2-amine |
| SMILES | CC(N)C(C)n1cncn1 |
| InChI | InChI=1S/C6H12N4/c1-5(7)6(2)10-4-8-3-9-10/h3-6H,7H2,1-2H3 |
| InChIKey | YYLBLMYFEQNWIL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |