About ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate
ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate (PubChem CID 50988005) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate |
| PubChem CID | 50988005 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate |
| SMILES | CCOC(=O)Cc1nc(C)no1 |
| InChI | InChI=1S/C7H10N2O3/c1-3-11-7(10)4-6-8-5(2)9-12-6/h3-4H2,1-2H3 |
| InChIKey | JHHMWBAJEQAUSH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate?
The IUPAC name of ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate (CID 50988005) is ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate.
What is the SMILES notation for ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate?
The canonical SMILES for ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate is CCOC(=O)Cc1nc(C)no1.
What is the InChIKey of ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate?
The InChIKey is JHHMWBAJEQAUSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-3-11-7(10)4-6-8-5(2)9-12-6/h3-4H2,1-2H3.
What are the key properties of ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate?
ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate has a molecular weight of 170.17 g/mol, XLogP of 0.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)acetate is sourced from PubChem (CID 50988005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).