C11H16ClN3O3 — CID 50988151
3-methyl-1-(2-oxo-2-piperazin-1-ylethyl)pyrrole-2,5-dione;hydrochloride (PubChem CID 50988151) has the molecular formula C11H16ClN3O3 and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-methyl-1-(2-oxo-2-piperazin-1-ylethyl)pyrrole-2,5-dione;hydrochloride.
| Compound Name | 3-methyl-1-(2-oxo-2-piperazin-1-ylethyl)pyrrole-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 50988151 |
| Molecular Formula | C11H16ClN3O3 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-methyl-1-(2-oxo-2-piperazin-1-ylethyl)pyrrole-2,5-dione;hydrochloride |
| SMILES | CC1=CC(=O)N(CC(=O)N2CCNCC2)C1=O.Cl |
| InChI | InChI=1S/C11H15N3O3.ClH/c1-8-6-9(15)14(11(8)17)7-10(16)13-4-2-12-3-5-13;/h6,12H,2-5,7H2,1H3;1H |
| InChIKey | YZQWZAAELUTJTH-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|