About 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride
1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride (PubChem CID 50988186) has the molecular formula C9H17Cl2N3
and a molecular weight of 238.16 g/mol. Its IUPAC name is 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride.
Molecular Properties
| Compound Name | 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride |
| PubChem CID | 50988186 |
| Molecular Formula | C9H17Cl2N3 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride |
| SMILES | Cc1nc(C)n(CCCCCCl)n1.Cl |
| InChI | InChI=1S/C9H16ClN3.ClH/c1-8-11-9(2)13(12-8)7-5-3-4-6-10;/h3-7H2,1-2H3;1H |
| InChIKey | RRDPVVAFVWPKQK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride?
The IUPAC name of 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride (CID 50988186) is 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride.
What is the SMILES notation for 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride?
The canonical SMILES for 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride is Cc1nc(C)n(CCCCCCl)n1.Cl.
What is the InChIKey of 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride?
The InChIKey is RRDPVVAFVWPKQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN3.ClH/c1-8-11-9(2)13(12-8)7-5-3-4-6-10;/h3-7H2,1-2H3;1H.
What are the key properties of 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride?
1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride has a molecular weight of 238.16 g/mol, XLogP of 2.73, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloropentyl)-3,5-dimethyl-1,2,4-triazole;hydrochloride is sourced from PubChem (CID 50988186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).