About 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride
3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride (PubChem CID 50988191) has the molecular formula C6H12ClN3O
and a molecular weight of 177.64 g/mol. Its IUPAC name is 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride |
| PubChem CID | 50988191 |
| Molecular Formula | C6H12ClN3O |
| Molecular Weight | 177.64 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride |
| SMILES | Cc1noc(CCCN)n1.Cl |
| InChI | InChI=1S/C6H11N3O.ClH/c1-5-8-6(10-9-5)3-2-4-7;/h2-4,7H2,1H3;1H |
| InChIKey | UICCPWNLOYUBBE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.64 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride?
The IUPAC name of 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride (CID 50988191) is 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride.
What is the SMILES notation for 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride?
The canonical SMILES for 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride is Cc1noc(CCCN)n1.Cl.
What is the InChIKey of 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride?
The InChIKey is UICCPWNLOYUBBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O.ClH/c1-5-8-6(10-9-5)3-2-4-7;/h2-4,7H2,1H3;1H.
What are the key properties of 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride?
3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride has a molecular weight of 177.64 g/mol, XLogP of 0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride is sourced from PubChem (CID 50988191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).