About ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate
ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate (PubChem CID 50988248) has the molecular formula C10H11NO2S2
and a molecular weight of 241.34 g/mol. Its IUPAC name is ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate |
| PubChem CID | 50988248 |
| Molecular Formula | C10H11NO2S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate |
| SMILES | CCOC(=O)c1sc2ccsc2c1CN |
| InChI | InChI=1S/C10H11NO2S2/c1-2-13-10(12)9-6(5-11)8-7(15-9)3-4-14-8/h3-4H,2,5,11H2,1H3 |
| InChIKey | VVJSRWIIPYTVHH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate?
The IUPAC name of ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate (CID 50988248) is ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate.
What is the SMILES notation for ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate?
The canonical SMILES for ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate is CCOC(=O)c1sc2ccsc2c1CN.
What is the InChIKey of ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate?
The InChIKey is VVJSRWIIPYTVHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S2/c1-2-13-10(12)9-6(5-11)8-7(15-9)3-4-14-8/h3-4H,2,5,11H2,1H3.
What are the key properties of ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate?
ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate has a molecular weight of 241.34 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylate is sourced from PubChem (CID 50988248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).