About 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride
2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride (PubChem CID 50988283) has the molecular formula C6H10Cl2N2OS
and a molecular weight of 229.13 g/mol. Its IUPAC name is 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride |
| PubChem CID | 50988283 |
| Molecular Formula | C6H10Cl2N2OS |
| Molecular Weight | 229.13 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride |
| SMILES | Cl.Cl.c1csc(OC2CNC2)n1 |
| InChI | InChI=1S/C6H8N2OS.2ClH/c1-2-10-6(8-1)9-5-3-7-4-5;;/h1-2,5,7H,3-4H2;2*1H |
| InChIKey | JJCMJHBDJLYNTC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.13 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride?
The IUPAC name of 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride (CID 50988283) is 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride.
What is the SMILES notation for 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride?
The canonical SMILES for 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride is Cl.Cl.c1csc(OC2CNC2)n1.
What is the InChIKey of 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride?
The InChIKey is JJCMJHBDJLYNTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS.2ClH/c1-2-10-6(8-1)9-5-3-7-4-5;;/h1-2,5,7H,3-4H2;2*1H.
What are the key properties of 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride?
2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride has a molecular weight of 229.13 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-3-yloxy)-1,3-thiazole;dihydrochloride is sourced from PubChem (CID 50988283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).