C9H18Cl2N4 — CID 50988337
3-(4-ethyl-1,2,4-triazol-3-yl)piperidine;dihydrochloride (PubChem CID 50988337) has the molecular formula C9H18Cl2N4 and a molecular weight of 253.18 g/mol. Its IUPAC name is 3-(4-ethyl-1,2,4-triazol-3-yl)piperidine;dihydrochloride.
| Compound Name | 3-(4-ethyl-1,2,4-triazol-3-yl)piperidine;dihydrochloride |
|---|---|
| PubChem CID | 50988337 |
| Molecular Formula | C9H18Cl2N4 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-(4-ethyl-1,2,4-triazol-3-yl)piperidine;dihydrochloride |
| SMILES | CCn1cnnc1C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C9H16N4.2ClH/c1-2-13-7-11-12-9(13)8-4-3-5-10-6-8;;/h7-8,10H,2-6H2,1H3;2*1H |
| InChIKey | IEVFAKCYSXGOTI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |