About (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride
(4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride (PubChem CID 50988361) has the molecular formula C5H12Cl2N4
and a molecular weight of 199.08 g/mol. Its IUPAC name is (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride |
| PubChem CID | 50988361 |
| Molecular Formula | C5H12Cl2N4 |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride |
| SMILES | Cc1nnc(CN)n1C.Cl.Cl |
| InChI | InChI=1S/C5H10N4.2ClH/c1-4-7-8-5(3-6)9(4)2;;/h3,6H2,1-2H3;2*1H |
| InChIKey | KAELDAFSYHVIFS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The IUPAC name of (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride (CID 50988361) is (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride.
What is the SMILES notation for (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The canonical SMILES for (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride is Cc1nnc(CN)n1C.Cl.Cl.
What is the InChIKey of (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The InChIKey is KAELDAFSYHVIFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4.2ClH/c1-4-7-8-5(3-6)9(4)2;;/h3,6H2,1-2H3;2*1H.
What are the key properties of (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
(4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride has a molecular weight of 199.08 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride is sourced from PubChem (CID 50988361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).