About 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride
4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride (PubChem CID 50988374) has the molecular formula C5H11Cl2N3S
and a molecular weight of 216.14 g/mol. Its IUPAC name is 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride |
| PubChem CID | 50988374 |
| Molecular Formula | C5H11Cl2N3S |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride |
| SMILES | CNc1nc(CN)cs1.Cl.Cl |
| InChI | InChI=1S/C5H9N3S.2ClH/c1-7-5-8-4(2-6)3-9-5;;/h3H,2,6H2,1H3,(H,7,8);2*1H |
| InChIKey | XNCAVSMDBFEXAZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride?
The IUPAC name of 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride (CID 50988374) is 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride.
What is the SMILES notation for 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride?
The canonical SMILES for 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride is CNc1nc(CN)cs1.Cl.Cl.
What is the InChIKey of 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride?
The InChIKey is XNCAVSMDBFEXAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S.2ClH/c1-7-5-8-4(2-6)3-9-5;;/h3H,2,6H2,1H3,(H,7,8);2*1H.
What are the key properties of 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride?
4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride has a molecular weight of 216.14 g/mol, XLogP of 1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-N-methyl-1,3-thiazol-2-amine;dihydrochloride is sourced from PubChem (CID 50988374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).