About N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride
N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride (PubChem CID 50988377) has the molecular formula C8H13Cl2N3S
and a molecular weight of 254.19 g/mol. Its IUPAC name is N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride |
| PubChem CID | 50988377 |
| Molecular Formula | C8H13Cl2N3S |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride |
| SMILES | CNCc1c(C)nc2sccn12.Cl.Cl |
| InChI | InChI=1S/C8H11N3S.2ClH/c1-6-7(5-9-2)11-3-4-12-8(11)10-6;;/h3-4,9H,5H2,1-2H3;2*1H |
| InChIKey | NSUOGXODVZIXJM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride?
The IUPAC name of N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride (CID 50988377) is N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride.
What is the SMILES notation for N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride?
The canonical SMILES for N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride is CNCc1c(C)nc2sccn12.Cl.Cl.
What is the InChIKey of N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride?
The InChIKey is NSUOGXODVZIXJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S.2ClH/c1-6-7(5-9-2)11-3-4-12-8(11)10-6;;/h3-4,9H,5H2,1-2H3;2*1H.
What are the key properties of N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride?
N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride has a molecular weight of 254.19 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride is sourced from PubChem (CID 50988377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).