C7H14Cl2F2N2 — CID 50988389
(8aS)-7,7-difluoro-2,3,4,6,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride (PubChem CID 50988389) has the molecular formula C7H14Cl2F2N2 and a molecular weight of 235.10 g/mol. Its IUPAC name is (8aS)-7,7-difluoro-2,3,4,6,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride.
| Compound Name | (8aS)-7,7-difluoro-2,3,4,6,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride |
|---|---|
| PubChem CID | 50988389 |
| Molecular Formula | C7H14Cl2F2N2 |
| Molecular Weight | 235.10 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (8aS)-7,7-difluoro-2,3,4,6,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride |
| SMILES | Cl.Cl.FC1(F)C[C@H]2CNCCN2C1 |
| InChI | InChI=1S/C7H12F2N2.2ClH/c8-7(9)3-6-4-10-1-2-11(6)5-7;;/h6,10H,1-5H2;2*1H/t6-;;/m0../s1 |
| InChIKey | QZJJVCXSBJSFOG-ILKKLZGPSA-N |
| XLogP | 1.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.10 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |