About 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride
6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride (PubChem CID 50988445) has the molecular formula C9H10BrCl2N
and a molecular weight of 283.00 g/mol. Its IUPAC name is 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride.
Molecular Properties
| Compound Name | 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride |
| PubChem CID | 50988445 |
| Molecular Formula | C9H10BrCl2N |
| Molecular Weight | 283.00 g/mol |
| Exact Mass | 280.94 |
| IUPAC Name | 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride |
| SMILES | Cl.Clc1cc(Br)cc2c1NCCC2 |
| InChI | InChI=1S/C9H9BrClN.ClH/c10-7-4-6-2-1-3-12-9(6)8(11)5-7;/h4-5,12H,1-3H2;1H |
| InChIKey | UFQYGFXSOJZKEO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.00 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride?
The IUPAC name of 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride (CID 50988445) is 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride.
What is the SMILES notation for 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride?
The canonical SMILES for 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride is Cl.Clc1cc(Br)cc2c1NCCC2.
What is the InChIKey of 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride?
The InChIKey is UFQYGFXSOJZKEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrClN.ClH/c10-7-4-6-2-1-3-12-9(6)8(11)5-7;/h4-5,12H,1-3H2;1H.
What are the key properties of 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride?
6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride has a molecular weight of 283.00 g/mol, XLogP of 3.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride is sourced from PubChem (CID 50988445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).