C9H11Cl2N — CID 50988446
8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride (PubChem CID 50988446) has the molecular formula C9H11Cl2N and a molecular weight of 204.10 g/mol. Its IUPAC name is 8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride.
| Compound Name | 8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 50988446 |
| Molecular Formula | C9H11Cl2N |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 8-chloro-1,2,3,4-tetrahydroquinoline;hydrochloride |
| SMILES | Cl.Clc1cccc2c1NCCC2 |
| InChI | InChI=1S/C9H10ClN.ClH/c10-8-5-1-3-7-4-2-6-11-9(7)8;/h1,3,5,11H,2,4,6H2;1H |
| InChIKey | GPBWNHANBOLYQM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |