About 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride
3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride (PubChem CID 50988486) has the molecular formula C7H11Cl2N3
and a molecular weight of 208.09 g/mol. Its IUPAC name is 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride.
Molecular Properties
| Compound Name | 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride |
| PubChem CID | 50988486 |
| Molecular Formula | C7H11Cl2N3 |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride |
| SMILES | Cl.Cn1c(CCl)nnc1C1CC1 |
| InChI | InChI=1S/C7H10ClN3.ClH/c1-11-6(4-8)9-10-7(11)5-2-3-5;/h5H,2-4H2,1H3;1H |
| InChIKey | DEUOKWTVVPIMBR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride?
The IUPAC name of 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride (CID 50988486) is 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride.
What is the SMILES notation for 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride?
The canonical SMILES for 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride is Cl.Cn1c(CCl)nnc1C1CC1.
What is the InChIKey of 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride?
The InChIKey is DEUOKWTVVPIMBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3.ClH/c1-11-6(4-8)9-10-7(11)5-2-3-5;/h5H,2-4H2,1H3;1H.
What are the key properties of 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride?
3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride has a molecular weight of 208.09 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-5-cyclopropyl-4-methyl-1,2,4-triazole;hydrochloride is sourced from PubChem (CID 50988486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).