About 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride
4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride (PubChem CID 50988501) has the molecular formula C11H13BrClN3
and a molecular weight of 302.60 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride |
| PubChem CID | 50988501 |
| Molecular Formula | C11H13BrClN3 |
| Molecular Weight | 302.60 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride |
| SMILES | Cc1nn(C)c(N)c1-c1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C11H12BrN3.ClH/c1-7-10(11(13)15(2)14-7)8-3-5-9(12)6-4-8;/h3-6H,13H2,1-2H3;1H |
| InChIKey | NKQQUIJARLBWPZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride?
The IUPAC name of 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride (CID 50988501) is 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride.
What is the SMILES notation for 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride?
The canonical SMILES for 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride is Cc1nn(C)c(N)c1-c1ccc(Br)cc1.Cl.
What is the InChIKey of 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride?
The InChIKey is NKQQUIJARLBWPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrN3.ClH/c1-7-10(11(13)15(2)14-7)8-3-5-9(12)6-4-8;/h3-6H,13H2,1-2H3;1H.
What are the key properties of 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride?
4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride has a molecular weight of 302.60 g/mol, XLogP of 3.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine;hydrochloride is sourced from PubChem (CID 50988501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).