About 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride
6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (PubChem CID 50988685) has the molecular formula C9H11ClFN
and a molecular weight of 187.65 g/mol. Its IUPAC name is 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| PubChem CID | 50988685 |
| Molecular Formula | C9H11ClFN |
| Molecular Weight | 187.65 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| SMILES | Cl.NC1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C9H10FN.ClH/c10-7-3-1-6-2-4-9(11)8(6)5-7;/h1,3,5,9H,2,4,11H2;1H |
| InChIKey | INNMZPPLAARVHQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.65 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The IUPAC name of 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CID 50988685) is 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride.
What is the SMILES notation for 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The canonical SMILES for 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride is Cl.NC1CCc2ccc(F)cc21.
What is the InChIKey of 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The InChIKey is INNMZPPLAARVHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN.ClH/c10-7-3-1-6-2-4-9(11)8(6)5-7;/h1,3,5,9H,2,4,11H2;1H.
What are the key properties of 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride?
6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride has a molecular weight of 187.65 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride is sourced from PubChem (CID 50988685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).