About 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride
6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (PubChem CID 50988686) has the molecular formula C8H8Cl3NO
and a molecular weight of 240.52 g/mol. Its IUPAC name is 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| PubChem CID | 50988686 |
| Molecular Formula | C8H8Cl3NO |
| Molecular Weight | 240.52 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| SMILES | Cl.NC1COc2c1ccc(Cl)c2Cl |
| InChI | InChI=1S/C8H7Cl2NO.ClH/c9-5-2-1-4-6(11)3-12-8(4)7(5)10;/h1-2,6H,3,11H2;1H |
| InChIKey | WKSMBXXHCXDUIJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride?
The IUPAC name of 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CID 50988686) is 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride.
What is the SMILES notation for 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride?
The canonical SMILES for 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride is Cl.NC1COc2c1ccc(Cl)c2Cl.
What is the InChIKey of 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride?
The InChIKey is WKSMBXXHCXDUIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2NO.ClH/c9-5-2-1-4-6(11)3-12-8(4)7(5)10;/h1-2,6H,3,11H2;1H.
What are the key properties of 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride?
6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride has a molecular weight of 240.52 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride is sourced from PubChem (CID 50988686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).