About quinolin-8-ylmethanamine;hydrochloride
quinolin-8-ylmethanamine;hydrochloride (PubChem CID 50988699) has the molecular formula C10H11ClN2
and a molecular weight of 194.67 g/mol. Its IUPAC name is quinolin-8-ylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | quinolin-8-ylmethanamine;hydrochloride |
| PubChem CID | 50988699 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.67 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | quinolin-8-ylmethanamine;hydrochloride |
| SMILES | Cl.NCc1cccc2cccnc12 |
| InChI | InChI=1S/C10H10N2.ClH/c11-7-9-4-1-3-8-5-2-6-12-10(8)9;/h1-6H,7,11H2;1H |
| InChIKey | BFMBFIOWYGKDKZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.67 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinolin-8-ylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-ylmethanamine;hydrochloride?
The IUPAC name of quinolin-8-ylmethanamine;hydrochloride (CID 50988699) is quinolin-8-ylmethanamine;hydrochloride.
What is the SMILES notation for quinolin-8-ylmethanamine;hydrochloride?
The canonical SMILES for quinolin-8-ylmethanamine;hydrochloride is Cl.NCc1cccc2cccnc12.
What is the InChIKey of quinolin-8-ylmethanamine;hydrochloride?
The InChIKey is BFMBFIOWYGKDKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.ClH/c11-7-9-4-1-3-8-5-2-6-12-10(8)9;/h1-6H,7,11H2;1H.
What are the key properties of quinolin-8-ylmethanamine;hydrochloride?
quinolin-8-ylmethanamine;hydrochloride has a molecular weight of 194.67 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-ylmethanamine;hydrochloride is sourced from PubChem (CID 50988699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).