About 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate
4-(methylamino)-1,2,5-thiadiazole-3-carboxylate (PubChem CID 5098937) has the molecular formula C4H4N3O2S-
and a molecular weight of 158.16 g/mol. Its IUPAC name is 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate.
Molecular Properties
| Compound Name | 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate |
| PubChem CID | 5098937 |
| Molecular Formula | C4H4N3O2S- |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate |
| SMILES | CNc1nsnc1C(=O)[O-] |
| InChI | InChI=1S/C4H5N3O2S/c1-5-3-2(4(8)9)6-10-7-3/h1H3,(H,5,7)(H,8,9)/p-1 |
| InChIKey | VEUMOQOGIIKOBV-UHFFFAOYSA-M |
| XLogP | -1.06 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate?
The IUPAC name of 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate (CID 5098937) is 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate.
What is the SMILES notation for 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate?
The canonical SMILES for 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate is CNc1nsnc1C(=O)[O-].
What is the InChIKey of 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate?
The InChIKey is VEUMOQOGIIKOBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H5N3O2S/c1-5-3-2(4(8)9)6-10-7-3/h1H3,(H,5,7)(H,8,9)/p-1.
What are the key properties of 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate?
4-(methylamino)-1,2,5-thiadiazole-3-carboxylate has a molecular weight of 158.16 g/mol, XLogP of -1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)-1,2,5-thiadiazole-3-carboxylate is sourced from PubChem (CID 5098937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).