C13H19NO — CID 50989531
[(1S,2R,5R)-2-amino-5-phenylcyclohexyl]methanol (PubChem CID 50989531) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is [(1S,2R,5R)-2-amino-5-phenylcyclohexyl]methanol.
| Compound Name | [(1S,2R,5R)-2-amino-5-phenylcyclohexyl]methanol |
|---|---|
| PubChem CID | 50989531 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | [(1S,2R,5R)-2-amino-5-phenylcyclohexyl]methanol |
| SMILES | N[C@@H]1CC[C@@H](c2ccccc2)C[C@@H]1CO |
| InChI | InChI=1S/C13H19NO/c14-13-7-6-11(8-12(13)9-15)10-4-2-1-3-5-10/h1-5,11-13,15H,6-9,14H2/t11-,12-,13-/m1/s1 |
| InChIKey | LUMAPUYZQIKJQG-JHJVBQTASA-N |
| XLogP | 1.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |