About 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine
5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine (PubChem CID 50989750) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine.
Analyze 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine?
The IUPAC name of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine (CID 50989750) is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine.
What is the SMILES notation for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine?
The canonical SMILES for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine is NCc1cnc2n1CCCC2.
What is the InChIKey of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine?
The InChIKey is JEZRDACHQQVYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c9-5-7-6-10-8-3-1-2-4-11(7)8/h6H,1-5,9H2.
What are the key properties of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine?
5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine has a molecular weight of 151.21 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethanamine is sourced from PubChem (CID 50989750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).