C7H10N2O4S — CID 50990314
8,8-dioxo-8λ6-thia-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 50990314) has the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. Its IUPAC name is 8,8-dioxo-8λ6-thia-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8,8-dioxo-8λ6-thia-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 50990314 |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 8,8-dioxo-8λ6-thia-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCS(=O)(=O)CC2)N1 |
| InChI | InChI=1S/C7H10N2O4S/c10-5-7(9-6(11)8-5)1-3-14(12,13)4-2-7/h1-4H2,(H2,8,9,10,11) |
| InChIKey | JVWBXSSEPJUHCK-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|