C7H10N2O2 — CID 50990315
3a,4,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 50990315) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 3a,4,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 50990315 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 3a,4,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | O=C1NC(=O)C2CNCCC12 |
| InChI | InChI=1S/C7H10N2O2/c10-6-4-1-2-8-3-5(4)7(11)9-6/h4-5,8H,1-3H2,(H,9,10,11) |
| InChIKey | NTTSIFKFFVZGMO-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|