About 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid
2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 50990526) has the molecular formula C8H5NO3S
and a molecular weight of 195.20 g/mol. Its IUPAC name is 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 50990526 |
| Molecular Formula | C8H5NO3S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2ccoc2)n1 |
| InChI | InChI=1S/C8H5NO3S/c10-8(11)6-4-13-7(9-6)5-1-2-12-3-5/h1-4H,(H,10,11) |
| InChIKey | RJBIGXLKMIWZOW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid (CID 50990526) is 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(-c2ccoc2)n1.
What is the InChIKey of 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is RJBIGXLKMIWZOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3S/c10-8(11)6-4-13-7(9-6)5-1-2-12-3-5/h1-4H,(H,10,11).
What are the key properties of 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid?
2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 195.20 g/mol, XLogP of 2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-3-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 50990526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).