C24H28FN6O7P — CID 50990955
ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 50990955) has the molecular formula C24H28FN6O7P and a molecular weight of 562.50 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 50990955 |
| Molecular Formula | C24H28FN6O7P |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H28FN6O7P/c1-4-35-22(33)15(2)30-39(34,38-16-8-6-5-7-9-16)36-12-18-20(32)23(3,25)24(13-26,37-18)19-11-10-17-21(27)28-14-29-31(17)19/h5-11,14-15,18,20,32H,4,12H2,1-3H3,(H,30,34)(H2,27,28,29)/t15-,18+,20+,23+,24-,39?/m0/s1 |
| InChIKey | JJTRAUWBUHSXAD-KHKPUGPUSA-N |
| XLogP | 2.26 |
| TPSA | 183.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|