About 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid
3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid (PubChem CID 50991018) has the molecular formula C24H19N3O2
and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid |
| PubChem CID | 50991018 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(-c3ccccc3)c(N3CCCc4ccccc43)nc2c1 |
| InChI | InChI=1S/C24H19N3O2/c28-24(29)18-12-13-19-20(15-18)26-23(22(25-19)17-8-2-1-3-9-17)27-14-6-10-16-7-4-5-11-21(16)27/h1-5,7-9,11-13,15H,6,10,14H2,(H,28,29) |
| InChIKey | QNTAFDGTGJMGAA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid?
The IUPAC name of 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid (CID 50991018) is 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid.
What is the SMILES notation for 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid?
The canonical SMILES for 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid is O=C(O)c1ccc2nc(-c3ccccc3)c(N3CCCc4ccccc43)nc2c1.
What is the InChIKey of 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid?
The InChIKey is QNTAFDGTGJMGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N3O2/c28-24(29)18-12-13-19-20(15-18)26-23(22(25-19)17-8-2-1-3-9-17)27-14-6-10-16-7-4-5-11-21(16)27/h1-5,7-9,11-13,15H,6,10,14H2,(H,28,29).
What are the key properties of 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid?
3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid has a molecular weight of 381.44 g/mol, XLogP of 5.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylquinoxaline-6-carboxylic acid is sourced from PubChem (CID 50991018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).