C16H19ClFN3O2 — CID 50991031
N-[3-[(3R)-5-amino-3-methyl-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorophenyl]-3-chlorocyclobutane-1-carboxamide (PubChem CID 50991031) has the molecular formula C16H19ClFN3O2 and a molecular weight of 339.80 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3-methyl-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorophenyl]-3-chlorocyclobutane-1-carboxamide.
| Compound Name | N-[3-[(3R)-5-amino-3-methyl-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorophenyl]-3-chlorocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 50991031 |
| Molecular Formula | C16H19ClFN3O2 |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-[3-[(3R)-5-amino-3-methyl-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorophenyl]-3-chlorocyclobutane-1-carboxamide |
| SMILES | C[C@@]1(c2cc(NC(=O)C3CC(Cl)C3)ccc2F)COCC(N)=N1 |
| InChI | InChI=1S/C16H19ClFN3O2/c1-16(8-23-7-14(19)21-16)12-6-11(2-3-13(12)18)20-15(22)9-4-10(17)5-9/h2-3,6,9-10H,4-5,7-8H2,1H3,(H2,19,21)(H,20,22)/t9?,10?,16-/m0/s1 |
| InChIKey | WXNYZEDXTIEOKR-HWYSMQLTSA-N |
| XLogP | 2.38 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|