C14H14F5N3O2 — CID 50991319
N-[3-[(3R)-5-amino-3-methyl-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorophenyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 50991319) has the molecular formula C14H14F5N3O2 and a molecular weight of 351.28 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3-methyl-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorophenyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[3-[(3R)-5-amino-3-methyl-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorophenyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 50991319 |
| Molecular Formula | C14H14F5N3O2 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[3-[(3R)-5-amino-3-methyl-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorophenyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | C[C@@]1(c2cc(NC(=O)C(F)(F)C(F)F)ccc2F)COCC(N)=N1 |
| InChI | InChI=1S/C14H14F5N3O2/c1-13(6-24-5-10(20)22-13)8-4-7(2-3-9(8)15)21-12(23)14(18,19)11(16)17/h2-4,11H,5-6H2,1H3,(H2,20,22)(H,21,23)/t13-/m0/s1 |
| InChIKey | UNUOKFFBJINEQA-ZDUSSCGKSA-N |
| XLogP | 2.27 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|