About 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine
5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine (PubChem CID 50991337) has the molecular formula C14H9FN4O2
and a molecular weight of 284.25 g/mol. Its IUPAC name is 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine |
| PubChem CID | 50991337 |
| Molecular Formula | C14H9FN4O2 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2cc(-c3cc(F)c4oc(N)nc4c3)ccc2o1 |
| InChI | InChI=1S/C14H9FN4O2/c15-8-3-7(5-10-12(8)21-14(17)19-10)6-1-2-11-9(4-6)18-13(16)20-11/h1-5H,(H2,16,18)(H2,17,19) |
| InChIKey | NNPAZJJXFYKULG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine?
The IUPAC name of 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine (CID 50991337) is 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine.
What is the SMILES notation for 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine?
The canonical SMILES for 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine is Nc1nc2cc(-c3cc(F)c4oc(N)nc4c3)ccc2o1.
What is the InChIKey of 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine?
The InChIKey is NNPAZJJXFYKULG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN4O2/c15-8-3-7(5-10-12(8)21-14(17)19-10)6-1-2-11-9(4-6)18-13(16)20-11/h1-5H,(H2,16,18)(H2,17,19).
What are the key properties of 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine?
5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine has a molecular weight of 284.25 g/mol, XLogP of 2.94, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-amino-1,3-benzoxazol-5-yl)-7-fluoro-1,3-benzoxazol-2-amine is sourced from PubChem (CID 50991337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).