C32H37N5O4 — CID 50991474
1-ethyl-3,3,5-trimethyl-7-[2-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]ethyl]-1,5-benzodiazepine-2,4-dione (PubChem CID 50991474) has the molecular formula C32H37N5O4 and a molecular weight of 555.68 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[2-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]ethyl]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[2-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]ethyl]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 50991474 |
| Molecular Formula | C32H37N5O4 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[2-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]ethyl]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CCN(CCn3ccc4occc4c3=O)Cc3cccnc3C)ccc21 |
| InChI | InChI=1S/C32H37N5O4/c1-6-37-26-10-9-23(20-27(26)34(5)30(39)32(3,4)31(37)40)11-15-35(21-24-8-7-14-33-22(24)2)17-18-36-16-12-28-25(29(36)38)13-19-41-28/h7-10,12-14,16,19-20H,6,11,15,17-18,21H2,1-5H3 |
| InChIKey | BFTZNPALLKWPGM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|