C30H34N4O3 — CID 50991553
N-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)methyl]-4-methyl-N-(2-pyridin-3-ylethyl)benzamide (PubChem CID 50991553) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)methyl]-4-methyl-N-(2-pyridin-3-ylethyl)benzamide.
| Compound Name | N-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)methyl]-4-methyl-N-(2-pyridin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 50991553 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | N-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)methyl]-4-methyl-N-(2-pyridin-3-ylethyl)benzamide |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CN(CCc3cccnc3)C(=O)c3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C30H34N4O3/c1-6-34-25-14-11-23(18-26(25)32(5)28(36)30(3,4)29(34)37)20-33(17-15-22-8-7-16-31-19-22)27(35)24-12-9-21(2)10-13-24/h7-14,16,18-19H,6,15,17,20H2,1-5H3 |
| InChIKey | PRVGYDQGFXHPSL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|