C33H31F2N5O2 — CID 50991949
(3R)-3'-[[2-(3,5-difluorophenyl)-2,4,5,5-tetramethyl-6-oxopiperazin-1-yl]methyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2-one (PubChem CID 50991949) has the molecular formula C33H31F2N5O2 and a molecular weight of 567.64 g/mol. Its IUPAC name is (3R)-3'-[[2-(3,5-difluorophenyl)-2,4,5,5-tetramethyl-6-oxopiperazin-1-yl]methyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2-one.
| Compound Name | (3R)-3'-[[2-(3,5-difluorophenyl)-2,4,5,5-tetramethyl-6-oxopiperazin-1-yl]methyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2-one |
|---|---|
| PubChem CID | 50991949 |
| Molecular Formula | C33H31F2N5O2 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | (3R)-3'-[[2-(3,5-difluorophenyl)-2,4,5,5-tetramethyl-6-oxopiperazin-1-yl]methyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2-one |
| SMILES | CN1CC(C)(c2cc(F)cc(F)c2)N(Cc2cnc3cc4c(cc3c2)C[C@]2(C4)C(=O)Nc3ncccc32)C(=O)C1(C)C |
| InChI | InChI=1S/C33H31F2N5O2/c1-31(2)30(42)40(32(3,18-39(31)4)23-11-24(34)13-25(35)12-23)17-19-8-20-9-21-14-33(15-22(21)10-27(20)37-16-19)26-6-5-7-36-28(26)38-29(33)41/h5-13,16H,14-15,17-18H2,1-4H3,(H,36,38,41)/t32?,33-/m1/s1 |
| InChIKey | VEBQHRMTXVSYJB-ZHZZGXISSA-N |
| XLogP | 4.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |