C21H28N8O2 — CID 50992060
5-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)oxypropoxy]phenyl]-6-ethylpyrimidine-2,4-diamine (PubChem CID 50992060) has the molecular formula C21H28N8O2 and a molecular weight of 424.51 g/mol. Its IUPAC name is 5-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)oxypropoxy]phenyl]-6-ethylpyrimidine-2,4-diamine.
| Compound Name | 5-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)oxypropoxy]phenyl]-6-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 50992060 |
| Molecular Formula | C21H28N8O2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 5-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)oxypropoxy]phenyl]-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1OCCCOc1cccc(-c2c(N)nc(N)nc2CC)c1 |
| InChI | InChI=1S/C21H28N8O2/c1-3-14-16(18(22)28-20(24)26-14)12-7-5-8-13(11-12)30-9-6-10-31-17-15(4-2)27-21(25)29-19(17)23/h5,7-8,11H,3-4,6,9-10H2,1-2H3,(H4,22,24,26,28)(H4,23,25,27,29) |
| InChIKey | IMDBCJZTZFNOKU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 174.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|