C18H25KN4O3S — CID 50992258
potassium 6-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propyl-deuteriocarbamoyl]-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-5-oxo-[1,3]thiazolo[5,4-b]pyridin-7-olate (PubChem CID 50992258) has the molecular formula C18H25KN4O3S and a molecular weight of 434.70 g/mol. Its IUPAC name is potassium 6-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propyl-deuteriocarbamoyl]-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-5-oxo-[1,3]thiazolo[5,4-b]pyridin-7-olate.
| Compound Name | potassium 6-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propyl-deuteriocarbamoyl]-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-5-oxo-[1,3]thiazolo[5,4-b]pyridin-7-olate |
|---|---|
| PubChem CID | 50992258 |
| Molecular Formula | C18H25KN4O3S |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | potassium 6-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propyl-deuteriocarbamoyl]-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-5-oxo-[1,3]thiazolo[5,4-b]pyridin-7-olate |
| SMILES | [2H]N(CCCN1C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H])C(=O)c1c([O-])c2ncsc2n(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c1=O.[K+] |
| InChI | InChI=1S/C18H26N4O3S.K/c1-12(2)22-17(25)13(15(23)14-18(22)26-11-20-14)16(24)19-7-6-10-21-8-4-3-5-9-21;/h11-12,23H,3-10H2,1-2H3,(H,19,24);/q;+1/p-1/i1D3,2D3,3D2,4D2,5D2,8D2,9D2,12D;/hD |
| InChIKey | VWJUVLDQRXIEMC-UIJUFTQZSA-M |
| XLogP | -1.28 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |