C29H29N7O3 — CID 50992290
(E)-3-[4-(1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]-1-(4-methylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 50992290) has the molecular formula C29H29N7O3 and a molecular weight of 523.60 g/mol. Its IUPAC name is (E)-3-[4-(1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]-1-(4-methylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]-1-(4-methylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 50992290 |
| Molecular Formula | C29H29N7O3 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | (E)-3-[4-(1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]-1-(4-methylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | CN1CCN(C(=O)/C=C/c2cnc3oc4c(N5CCOCC5)nc(-c5cccc6[nH]ccc56)nc4c3c2)CC1 |
| InChI | InChI=1S/C29H29N7O3/c1-34-9-11-35(12-10-34)24(37)6-5-19-17-22-25-26(39-29(22)31-18-19)28(36-13-15-38-16-14-36)33-27(32-25)21-3-2-4-23-20(21)7-8-30-23/h2-8,17-18,30H,9-16H2,1H3/b6-5+ |
| InChIKey | YSIZOVLWZSAZSZ-AATRIKPKSA-N |
| XLogP | 3.54 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|