C26H26N6O3 — CID 50992385
4-(1H-indol-4-yl)-6-morpholin-4-yl-12-(morpholin-4-ylmethyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 50992385) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-(1H-indol-4-yl)-6-morpholin-4-yl-12-(morpholin-4-ylmethyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4-(1H-indol-4-yl)-6-morpholin-4-yl-12-(morpholin-4-ylmethyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 50992385 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-(1H-indol-4-yl)-6-morpholin-4-yl-12-(morpholin-4-ylmethyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | c1cc(-c2nc(N3CCOCC3)c3oc4ncc(CN5CCOCC5)cc4c3n2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C26H26N6O3/c1-2-19(18-4-5-27-21(18)3-1)24-29-22-20-14-17(16-31-6-10-33-11-7-31)15-28-26(20)35-23(22)25(30-24)32-8-12-34-13-9-32/h1-5,14-15,27H,6-13,16H2 |
| InChIKey | FQDZEXAWGGTCSJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |