About N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine
N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 50992468) has the molecular formula C24H17F3N2O
and a molecular weight of 406.41 g/mol. Its IUPAC name is N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine.
Molecular Properties
| Compound Name | N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine |
| PubChem CID | 50992468 |
| Molecular Formula | C24H17F3N2O |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | FC(F)(F)c1ccc(/C=N/C(c2ccccc2)c2cc(-c3ccccc3)on2)cc1 |
| InChI | InChI=1S/C24H17F3N2O/c25-24(26,27)20-13-11-17(12-14-20)16-28-23(19-9-5-2-6-10-19)21-15-22(30-29-21)18-7-3-1-4-8-18/h1-16,23H/b28-16+ |
| InChIKey | UIGBTOMKEIFYCB-LQKURTRISA-N |
| XLogP | 6.57 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine?
The IUPAC name of N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine (CID 50992468) is N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine.
What is the SMILES notation for N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine?
The canonical SMILES for N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine is FC(F)(F)c1ccc(/C=N/C(c2ccccc2)c2cc(-c3ccccc3)on2)cc1.
What is the InChIKey of N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine?
The InChIKey is UIGBTOMKEIFYCB-LQKURTRISA-N. The full InChI is InChI=1S/C24H17F3N2O/c25-24(26,27)20-13-11-17(12-14-20)16-28-23(19-9-5-2-6-10-19)21-15-22(30-29-21)18-7-3-1-4-8-18/h1-16,23H/b28-16+.
What are the key properties of N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine?
N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine has a molecular weight of 406.41 g/mol, XLogP of 6.57, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine is sourced from PubChem (CID 50992468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).