C24H17F3N2O — CID 50992468
N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 50992468) has the molecular formula C24H17F3N2O and a molecular weight of 406.41 g/mol. Its IUPAC name is N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 50992468 |
| Molecular Formula | C24H17F3N2O |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[phenyl-(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | FC(F)(F)c1ccc(/C=N/C(c2ccccc2)c2cc(-c3ccccc3)on2)cc1 |
| InChI | InChI=1S/C24H17F3N2O/c25-24(26,27)20-13-11-17(12-14-20)16-28-23(19-9-5-2-6-10-19)21-15-22(30-29-21)18-7-3-1-4-8-18/h1-16,23H/b28-16+ |
| InChIKey | UIGBTOMKEIFYCB-LQKURTRISA-N |
| XLogP | 6.57 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|