C27H33BrO7 — CID 50992827
[(2R,3R,4S,5R,6R)-2-bromo-4,5-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxan-3-yl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate (PubChem CID 50992827) has the molecular formula C27H33BrO7 and a molecular weight of 549.46 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2-bromo-4,5-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxan-3-yl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3R,4S,5R,6R)-2-bromo-4,5-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxan-3-yl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 50992827 |
| Molecular Formula | C27H33BrO7 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2-bromo-4,5-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxan-3-yl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate |
| SMILES | C=CCOC[C@H]1O[C@H](Br)[C@H](OC(=O)/C=C/c2ccc(OCC=C)cc2)[C@@H](OCC=C)[C@@H]1OCC=C |
| InChI | InChI=1S/C27H33BrO7/c1-5-15-30-19-22-24(32-17-7-3)25(33-18-8-4)26(27(28)34-22)35-23(29)14-11-20-9-12-21(13-10-20)31-16-6-2/h5-14,22,24-27H,1-4,15-19H2/b14-11+/t22-,24-,25+,26-,27+/m1/s1 |
| InChIKey | YCRRMKVKXQYCOO-HHIPGFGOSA-N |
| XLogP | 4.64 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|