About 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine
6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine (PubChem CID 50993080) has the molecular formula C14H21F2NO
and a molecular weight of 257.32 g/mol. Its IUPAC name is 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine.
Molecular Properties
| Compound Name | 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine |
| PubChem CID | 50993080 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine |
| SMILES | NCCCCCCOCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C14H21F2NO/c15-14(16,13-8-4-3-5-9-13)12-18-11-7-2-1-6-10-17/h3-5,8-9H,1-2,6-7,10-12,17H2 |
| InChIKey | ZAVGLNVUWHAKNQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine?
The IUPAC name of 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine (CID 50993080) is 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine.
What is the SMILES notation for 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine?
The canonical SMILES for 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine is NCCCCCCOCC(F)(F)c1ccccc1.
What is the InChIKey of 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine?
The InChIKey is ZAVGLNVUWHAKNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F2NO/c15-14(16,13-8-4-3-5-9-13)12-18-11-7-2-1-6-10-17/h3-5,8-9H,1-2,6-7,10-12,17H2.
What are the key properties of 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine?
6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine has a molecular weight of 257.32 g/mol, XLogP of 3.31, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-difluoro-2-phenylethoxy)hexan-1-amine is sourced from PubChem (CID 50993080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).