C25H30B2F2N2O2 — CID 50993266
2,2-difluoro-4,6,10,12-tetramethyl-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 50993266) has the molecular formula C25H30B2F2N2O2 and a molecular weight of 450.15 g/mol. Its IUPAC name is 2,2-difluoro-4,6,10,12-tetramethyl-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 50993266 |
| Molecular Formula | C25H30B2F2N2O2 |
| Molecular Weight | 450.15 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1ccc(B3OC(C)(C)C(C)(C)O3)cc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C25H30B2F2N2O2/c1-15-13-17(3)30-22(15)21(23-16(2)14-18(4)31(23)27(30,28)29)19-9-11-20(12-10-19)26-32-24(5,6)25(7,8)33-26/h9-14H,1-8H3 |
| InChIKey | MYISVEHPPDMHDZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.15 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|