About [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid
[5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid (PubChem CID 50993448) has the molecular formula C8H9N2O4PS
and a molecular weight of 260.21 g/mol. Its IUPAC name is [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid.
Molecular Properties
| Compound Name | [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid |
| PubChem CID | 50993448 |
| Molecular Formula | C8H9N2O4PS |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid |
| SMILES | Cc1sc(N)nc1-c1ccc(P(=O)(O)O)o1 |
| InChI | InChI=1S/C8H9N2O4PS/c1-4-7(10-8(9)16-4)5-2-3-6(14-5)15(11,12)13/h2-3H,1H3,(H2,9,10)(H2,11,12,13) |
| InChIKey | LQCHSMLGVOGEIH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid?
The IUPAC name of [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid (CID 50993448) is [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid.
What is the SMILES notation for [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid?
The canonical SMILES for [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid is Cc1sc(N)nc1-c1ccc(P(=O)(O)O)o1.
What is the InChIKey of [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid?
The InChIKey is LQCHSMLGVOGEIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N2O4PS/c1-4-7(10-8(9)16-4)5-2-3-6(14-5)15(11,12)13/h2-3H,1H3,(H2,9,10)(H2,11,12,13).
What are the key properties of [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid?
[5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid has a molecular weight of 260.21 g/mol, XLogP of 1.10, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-amino-5-methyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid is sourced from PubChem (CID 50993448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).