C19H18N2O4 — CID 50993521
2,6-dimethoxy-4-methyl-5-(3-methylphenyl)-8-nitroquinoline (PubChem CID 50993521) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2,6-dimethoxy-4-methyl-5-(3-methylphenyl)-8-nitroquinoline.
| Compound Name | 2,6-dimethoxy-4-methyl-5-(3-methylphenyl)-8-nitroquinoline |
|---|---|
| PubChem CID | 50993521 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2,6-dimethoxy-4-methyl-5-(3-methylphenyl)-8-nitroquinoline |
| SMILES | COc1cc(C)c2c(-c3cccc(C)c3)c(OC)cc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C19H18N2O4/c1-11-6-5-7-13(8-11)18-15(24-3)10-14(21(22)23)19-17(18)12(2)9-16(20-19)25-4/h5-10H,1-4H3 |
| InChIKey | RXLLTBFWNRWLIG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|