C12H17N2O4PS — CID 50993523
[5-[2-amino-5-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid (PubChem CID 50993523) has the molecular formula C12H17N2O4PS and a molecular weight of 316.32 g/mol. Its IUPAC name is [5-[2-amino-5-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid.
| Compound Name | [5-[2-amino-5-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 50993523 |
| Molecular Formula | C12H17N2O4PS |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [5-[2-amino-5-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid |
| SMILES | CC(C)(C)Cc1sc(N)nc1-c1ccc(P(=O)(O)O)o1 |
| InChI | InChI=1S/C12H17N2O4PS/c1-12(2,3)6-8-10(14-11(13)20-8)7-4-5-9(18-7)19(15,16)17/h4-5H,6H2,1-3H3,(H2,13,14)(H2,15,16,17) |
| InChIKey | DZIHZGSPDNFJBW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|