C27H29NO8 — CID 50993611
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[hydroxy(phenyl)methyl]-7-methylindol-1-yl]oxan-3-yl] acetate (PubChem CID 50993611) has the molecular formula C27H29NO8 and a molecular weight of 495.53 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[hydroxy(phenyl)methyl]-7-methylindol-1-yl]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[hydroxy(phenyl)methyl]-7-methylindol-1-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 50993611 |
| Molecular Formula | C27H29NO8 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[hydroxy(phenyl)methyl]-7-methylindol-1-yl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1n1cc(C(O)c2ccccc2)c2cccc(C)c21 |
| InChI | InChI=1S/C27H29NO8/c1-15-9-8-12-20-21(24(32)19-10-6-5-7-11-19)13-28(23(15)20)27-26(36-18(4)31)25(35-17(3)30)22(14-33-27)34-16(2)29/h5-13,22,24-27,32H,14H2,1-4H3/t22-,24?,25+,26-,27-/m1/s1 |
| InChIKey | MAWHDNFHYGTGEE-RJXUSAAPSA-N |
| XLogP | 3.36 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|