C15H16O4 — CID 50993898
(1S,2R,4S,6S,8R,13S)-6-hydroxy-1,10-dimethyl-7,12-dioxapentacyclo[6.6.1.02,4.05,15.09,13]pentadeca-5(15),9-dien-11-one (PubChem CID 50993898) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (1S,2R,4S,6S,8R,13S)-6-hydroxy-1,10-dimethyl-7,12-dioxapentacyclo[6.6.1.02,4.05,15.09,13]pentadeca-5(15),9-dien-11-one.
| Compound Name | (1S,2R,4S,6S,8R,13S)-6-hydroxy-1,10-dimethyl-7,12-dioxapentacyclo[6.6.1.02,4.05,15.09,13]pentadeca-5(15),9-dien-11-one |
|---|---|
| PubChem CID | 50993898 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (1S,2R,4S,6S,8R,13S)-6-hydroxy-1,10-dimethyl-7,12-dioxapentacyclo[6.6.1.02,4.05,15.09,13]pentadeca-5(15),9-dien-11-one |
| SMILES | CC1=C2[C@@H]3O[C@H](O)C4=C3[C@@](C)(C[C@@H]2OC1=O)[C@@H]1C[C@H]41 |
| InChI | InChI=1S/C15H16O4/c1-5-9-8(18-13(5)16)4-15(2)7-3-6(7)10-11(15)12(9)19-14(10)17/h6-8,12,14,17H,3-4H2,1-2H3/t6-,7+,8-,12-,14-,15-/m0/s1 |
| InChIKey | IIFNVNIPMCRQPC-YIEVAYSQSA-N |
| XLogP | 1.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|