About 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride
1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride (PubChem CID 50993933) has the molecular formula C19H22ClNO
and a molecular weight of 315.84 g/mol. Its IUPAC name is 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride |
| PubChem CID | 50993933 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride |
| SMILES | CC1=CC(C)(C)N(Cc2ccccc2)c2ccc(O)cc21.Cl |
| InChI | InChI=1S/C19H21NO.ClH/c1-14-12-19(2,3)20(13-15-7-5-4-6-8-15)18-10-9-16(21)11-17(14)18;/h4-12,21H,13H2,1-3H3;1H |
| InChIKey | TUGZRFDQUHLPLH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride?
The IUPAC name of 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride (CID 50993933) is 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride.
What is the SMILES notation for 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride?
The canonical SMILES for 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride is CC1=CC(C)(C)N(Cc2ccccc2)c2ccc(O)cc21.Cl.
What is the InChIKey of 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride?
The InChIKey is TUGZRFDQUHLPLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO.ClH/c1-14-12-19(2,3)20(13-15-7-5-4-6-8-15)18-10-9-16(21)11-17(14)18;/h4-12,21H,13H2,1-3H3;1H.
What are the key properties of 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride?
1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride has a molecular weight of 315.84 g/mol, XLogP of 5.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,2,4-trimethylquinolin-6-ol;hydrochloride is sourced from PubChem (CID 50993933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).