C16H15F3N2O — CID 50994008
1-methyl-7-(4,4,4-trifluorobutoxy)-9H-pyrido[3,4-b]indole (PubChem CID 50994008) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is 1-methyl-7-(4,4,4-trifluorobutoxy)-9H-pyrido[3,4-b]indole.
| Compound Name | 1-methyl-7-(4,4,4-trifluorobutoxy)-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 50994008 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-methyl-7-(4,4,4-trifluorobutoxy)-9H-pyrido[3,4-b]indole |
| SMILES | Cc1nccc2c1[nH]c1cc(OCCCC(F)(F)F)ccc12 |
| InChI | InChI=1S/C16H15F3N2O/c1-10-15-13(5-7-20-10)12-4-3-11(9-14(12)21-15)22-8-2-6-16(17,18)19/h3-5,7,9,21H,2,6,8H2,1H3 |
| InChIKey | DTZUQYMIOUZBFU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|