About 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one
1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one (PubChem CID 50994067) has the molecular formula C16H19NO4
and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one.
Molecular Properties
| Compound Name | 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one |
| PubChem CID | 50994067 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one |
| SMILES | COc1cc(CCC(=O)n2cccc2)cc(OC)c1OC |
| InChI | InChI=1S/C16H19NO4/c1-19-13-10-12(11-14(20-2)16(13)21-3)6-7-15(18)17-8-4-5-9-17/h4-5,8-11H,6-7H2,1-3H3 |
| InChIKey | OEPMYHLWGJDONN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one?
The IUPAC name of 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one (CID 50994067) is 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one.
What is the SMILES notation for 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one?
The canonical SMILES for 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one is COc1cc(CCC(=O)n2cccc2)cc(OC)c1OC.
What is the InChIKey of 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one?
The InChIKey is OEPMYHLWGJDONN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4/c1-19-13-10-12(11-14(20-2)16(13)21-3)6-7-15(18)17-8-4-5-9-17/h4-5,8-11H,6-7H2,1-3H3.
What are the key properties of 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one?
1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one has a molecular weight of 289.33 g/mol, XLogP of 2.79, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrol-1-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one is sourced from PubChem (CID 50994067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).